C18H17ClN4O3S2 — CID 24649213
2-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-5-(propan-2-ylsulfamoyl)benzamide (PubChem CID 24649213) has the molecular formula C18H17ClN4O3S2 and a molecular weight of 436.95 g/mol. Its IUPAC name is 2-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-5-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-5-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24649213 |
| Molecular Formula | C18H17ClN4O3S2 |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 2-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)-5-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2nnc(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C18H17ClN4O3S2/c1-11(2)23-28(25,26)13-8-9-15(19)14(10-13)16(24)20-18-22-21-17(27-18)12-6-4-3-5-7-12/h3-11,23H,1-2H3,(H,20,22,24) |
| InChIKey | OHHDLIXSCGBVFG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |