C25H21N3O3S — CID 70789372
2-[(4-methylphenyl)sulfonylamino]-N-(6-phenyl-3-pyridinyl)benzamide (PubChem CID 70789372) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-N-(6-phenyl-3-pyridinyl)benzamide.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-N-(6-phenyl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 70789372 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-N-(6-phenyl-3-pyridinyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C(=O)Nc2ccc(-c3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c1-18-11-14-21(15-12-18)32(30,31)28-24-10-6-5-9-22(24)25(29)27-20-13-16-23(26-17-20)19-7-3-2-4-8-19/h2-17,28H,1H3,(H,27,29) |
| InChIKey | JZPSWWRMKQIPRS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |