C21H15ClN4O3S2 — CID 26843289
2-[(4-chlorophenyl)sulfonylamino]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 26843289) has the molecular formula C21H15ClN4O3S2 and a molecular weight of 470.96 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 26843289 |
| Molecular Formula | C21H15ClN4O3S2 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2cccnc2)cs1)c1ccccc1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15ClN4O3S2/c22-15-7-9-16(10-8-15)31(28,29)26-18-6-2-1-5-17(18)20(27)25-21-24-19(13-30-21)14-4-3-11-23-12-14/h1-13,26H,(H,24,25,27) |
| InChIKey | HWONMHIHCZBZSG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |