C15H8Cl2FN3OS — CID 18277166
2,4-dichloro-5-fluoro-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 18277166) has the molecular formula C15H8Cl2FN3OS and a molecular weight of 368.22 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 18277166 |
| Molecular Formula | C15H8Cl2FN3OS |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2cccnc2)cs1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H8Cl2FN3OS/c16-10-5-11(17)12(18)4-9(10)14(22)21-15-20-13(7-23-15)8-2-1-3-19-6-8/h1-7H,(H,20,21,22) |
| InChIKey | JMYIUFMRUJWHHT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|