C16H25BrN2O3S — CID 32537367
2-bromo-5-(tert-butylsulfamoyl)-N-[(2R)-pentan-2-yl]benzamide (PubChem CID 32537367) has the molecular formula C16H25BrN2O3S and a molecular weight of 405.36 g/mol. Its IUPAC name is 2-bromo-5-(tert-butylsulfamoyl)-N-[(2R)-pentan-2-yl]benzamide.
| Compound Name | 2-bromo-5-(tert-butylsulfamoyl)-N-[(2R)-pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 32537367 |
| Molecular Formula | C16H25BrN2O3S |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-bromo-5-(tert-butylsulfamoyl)-N-[(2R)-pentan-2-yl]benzamide |
| SMILES | CCC[C@@H](C)NC(=O)c1cc(S(=O)(=O)NC(C)(C)C)ccc1Br |
| InChI | InChI=1S/C16H25BrN2O3S/c1-6-7-11(2)18-15(20)13-10-12(8-9-14(13)17)23(21,22)19-16(3,4)5/h8-11,19H,6-7H2,1-5H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | LEDYSZHCKRSSCO-LLVKDONJSA-N |
| XLogP | 3.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |