C14H21BrN2O3S — CID 42940827
2-bromo-N-(5-methylhexan-2-yl)-5-sulfamoylbenzamide (PubChem CID 42940827) has the molecular formula C14H21BrN2O3S and a molecular weight of 377.30 g/mol. Its IUPAC name is 2-bromo-N-(5-methylhexan-2-yl)-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-(5-methylhexan-2-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 42940827 |
| Molecular Formula | C14H21BrN2O3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-bromo-N-(5-methylhexan-2-yl)-5-sulfamoylbenzamide |
| SMILES | CC(C)CCC(C)NC(=O)c1cc(S(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C14H21BrN2O3S/c1-9(2)4-5-10(3)17-14(18)12-8-11(21(16,19)20)6-7-13(12)15/h6-10H,4-5H2,1-3H3,(H,17,18)(H2,16,19,20) |
| InChIKey | NFMCXURLYIRHQP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |