C16H25BrN2O4S — CID 32886231
2-bromo-5-(tert-butylsulfamoyl)-N-(3-ethoxypropyl)benzamide (PubChem CID 32886231) has the molecular formula C16H25BrN2O4S and a molecular weight of 421.36 g/mol. Its IUPAC name is 2-bromo-5-(tert-butylsulfamoyl)-N-(3-ethoxypropyl)benzamide.
| Compound Name | 2-bromo-5-(tert-butylsulfamoyl)-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 32886231 |
| Molecular Formula | C16H25BrN2O4S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-bromo-5-(tert-butylsulfamoyl)-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cc(S(=O)(=O)NC(C)(C)C)ccc1Br |
| InChI | InChI=1S/C16H25BrN2O4S/c1-5-23-10-6-9-18-15(20)13-11-12(7-8-14(13)17)24(21,22)19-16(2,3)4/h7-8,11,19H,5-6,9-10H2,1-4H3,(H,18,20) |
| InChIKey | LGWDCUPATUAWGU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|