C16H25N3O4S — CID 31336695
5-(tert-butylsulfamoyl)-N-[2-(dimethylamino)-2-oxoethyl]-2-methylbenzamide (PubChem CID 31336695) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[2-(dimethylamino)-2-oxoethyl]-2-methylbenzamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[2-(dimethylamino)-2-oxoethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 31336695 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[2-(dimethylamino)-2-oxoethyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)(C)C)cc1C(=O)NCC(=O)N(C)C |
| InChI | InChI=1S/C16H25N3O4S/c1-11-7-8-12(24(22,23)18-16(2,3)4)9-13(11)15(21)17-10-14(20)19(5)6/h7-9,18H,10H2,1-6H3,(H,17,21) |
| InChIKey | SLJREIBWTJSKHW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |