C23H29ClN4O3S — CID 3000011
hydron;N-(3-imidazol-1-ylpropyl)-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide;chloride (PubChem CID 3000011) has the molecular formula C23H29ClN4O3S and a molecular weight of 477.03 g/mol. Its IUPAC name is hydron;N-(3-imidazol-1-ylpropyl)-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide;chloride.
| Compound Name | hydron;N-(3-imidazol-1-ylpropyl)-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide;chloride |
|---|---|
| PubChem CID | 3000011 |
| Molecular Formula | C23H29ClN4O3S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | hydron;N-(3-imidazol-1-ylpropyl)-2-[(2,3,5,6-tetramethylphenyl)sulfonylamino]benzamide;chloride |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)Nc2ccccc2C(=O)NCCCn2ccnc2)c1C.[Cl-].[H+] |
| InChI | InChI=1S/C23H28N4O3S.ClH/c1-16-14-17(2)19(4)22(18(16)3)31(29,30)26-21-9-6-5-8-20(21)23(28)25-10-7-12-27-13-11-24-15-27;/h5-6,8-9,11,13-15,26H,7,10,12H2,1-4H3,(H,25,28);1H |
| InChIKey | QPVGYPNSOBACPN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|