C19H17Cl3N4O3S — CID 13280079
N-(3-imidazol-1-ylpropyl)-2-[(2,3,4-trichlorophenyl)sulfonylamino]benzamide (PubChem CID 13280079) has the molecular formula C19H17Cl3N4O3S and a molecular weight of 487.80 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-[(2,3,4-trichlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-[(2,3,4-trichlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 13280079 |
| Molecular Formula | C19H17Cl3N4O3S |
| Molecular Weight | 487.80 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-[(2,3,4-trichlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccccc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C19H17Cl3N4O3S/c20-14-6-7-16(18(22)17(14)21)30(28,29)25-15-5-2-1-4-13(15)19(27)24-8-3-10-26-11-9-23-12-26/h1-2,4-7,9,11-12,25H,3,8,10H2,(H,24,27) |
| InChIKey | XVEVNDQJHFFAFM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|