C21H18F6N4O3S — CID 13280089
2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 13280089) has the molecular formula C21H18F6N4O3S and a molecular weight of 520.46 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 13280089 |
| Molecular Formula | C21H18F6N4O3S |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccccc1NS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F6N4O3S/c22-20(23,24)14-10-15(21(25,26)27)12-16(11-14)35(33,34)30-18-5-2-1-4-17(18)19(32)29-6-3-8-31-9-7-28-13-31/h1-2,4-5,7,9-13,30H,3,6,8H2,(H,29,32) |
| InChIKey | NCQNHGVMDYKNBM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|