C18H24N4O — CID 119846342
2-(4-aminophenyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]acetamide (PubChem CID 119846342) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]acetamide.
| Compound Name | 2-(4-aminophenyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 119846342 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-(4-aminophenyl)-N-[[6-(diethylamino)-3-pyridinyl]methyl]acetamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)Cc2ccc(N)cc2)cn1 |
| InChI | InChI=1S/C18H24N4O/c1-3-22(4-2)17-10-7-15(12-20-17)13-21-18(23)11-14-5-8-16(19)9-6-14/h5-10,12H,3-4,11,13,19H2,1-2H3,(H,21,23) |
| InChIKey | ZUOKMOAWKUCGDB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|