C21H25N5O2 — CID 55964795
N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(4-oxocinnolin-1-yl)propanamide (PubChem CID 55964795) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(4-oxocinnolin-1-yl)propanamide.
| Compound Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(4-oxocinnolin-1-yl)propanamide |
|---|---|
| PubChem CID | 55964795 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[[6-(diethylamino)-3-pyridinyl]methyl]-3-(4-oxocinnolin-1-yl)propanamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)CCn2ncc(=O)c3ccccc32)cn1 |
| InChI | InChI=1S/C21H25N5O2/c1-3-25(4-2)20-10-9-16(13-22-20)14-23-21(28)11-12-26-18-8-6-5-7-17(18)19(27)15-24-26/h5-10,13,15H,3-4,11-12,14H2,1-2H3,(H,23,28) |
| InChIKey | IQCRIMCIMKWVJQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |