C19H27N3O3 — CID 109381292
N-(3-hydroxy-2,2,4-trimethylpentyl)-3-(4-oxocinnolin-1-yl)propanamide (PubChem CID 109381292) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-(3-hydroxy-2,2,4-trimethylpentyl)-3-(4-oxocinnolin-1-yl)propanamide.
| Compound Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-3-(4-oxocinnolin-1-yl)propanamide |
|---|---|
| PubChem CID | 109381292 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-(3-hydroxy-2,2,4-trimethylpentyl)-3-(4-oxocinnolin-1-yl)propanamide |
| SMILES | CC(C)C(O)C(C)(C)CNC(=O)CCn1ncc(=O)c2ccccc21 |
| InChI | InChI=1S/C19H27N3O3/c1-13(2)18(25)19(3,4)12-20-17(24)9-10-22-15-8-6-5-7-14(15)16(23)11-21-22/h5-8,11,13,18,25H,9-10,12H2,1-4H3,(H,20,24) |
| InChIKey | DPYCGPIZIODIGK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |