C17H23N3O3 — CID 111480501
N-(4-hydroxy-2,2-dimethylpentyl)-2-(4-oxocinnolin-1-yl)acetamide (PubChem CID 111480501) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)-2-(4-oxocinnolin-1-yl)acetamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)-2-(4-oxocinnolin-1-yl)acetamide |
|---|---|
| PubChem CID | 111480501 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)-2-(4-oxocinnolin-1-yl)acetamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)Cn1ncc(=O)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O3/c1-12(21)8-17(2,3)11-18-16(23)10-20-14-7-5-4-6-13(14)15(22)9-19-20/h4-7,9,12,21H,8,10-11H2,1-3H3,(H,18,23) |
| InChIKey | VRTLLZLDDGYSAS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |