C22H24N4O4 — CID 25485810
N'-[2-(4-tert-butylphenoxy)acetyl]-2-(4-oxocinnolin-1-yl)acetohydrazide (PubChem CID 25485810) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N'-[2-(4-tert-butylphenoxy)acetyl]-2-(4-oxocinnolin-1-yl)acetohydrazide.
| Compound Name | N'-[2-(4-tert-butylphenoxy)acetyl]-2-(4-oxocinnolin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 25485810 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N'-[2-(4-tert-butylphenoxy)acetyl]-2-(4-oxocinnolin-1-yl)acetohydrazide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NNC(=O)Cn2ncc(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-22(2,3)15-8-10-16(11-9-15)30-14-21(29)25-24-20(28)13-26-18-7-5-4-6-17(18)19(27)12-23-26/h4-12H,13-14H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | XCUUXPTZRJWBDU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|