C20H21N5O3 — CID 9088380
2-(2,4-dimethylanilino)-N'-[2-(4-oxocinnolin-1-yl)acetyl]acetohydrazide (PubChem CID 9088380) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-N'-[2-(4-oxocinnolin-1-yl)acetyl]acetohydrazide.
| Compound Name | 2-(2,4-dimethylanilino)-N'-[2-(4-oxocinnolin-1-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 9088380 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-(2,4-dimethylanilino)-N'-[2-(4-oxocinnolin-1-yl)acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cn2ncc(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C20H21N5O3/c1-13-7-8-16(14(2)9-13)21-11-19(27)23-24-20(28)12-25-17-6-4-3-5-15(17)18(26)10-22-25/h3-10,21H,11-12H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | NUWUCIFZNNGWLT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|