C25H24N4O3 — CID 55513954
2-(2,4-dimethylanilino)-N'-[2-(9-oxoacridin-10-yl)acetyl]acetohydrazide (PubChem CID 55513954) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-(2,4-dimethylanilino)-N'-[2-(9-oxoacridin-10-yl)acetyl]acetohydrazide.
| Compound Name | 2-(2,4-dimethylanilino)-N'-[2-(9-oxoacridin-10-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55513954 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-(2,4-dimethylanilino)-N'-[2-(9-oxoacridin-10-yl)acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cn2c3ccccc3c(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C25H24N4O3/c1-16-11-12-20(17(2)13-16)26-14-23(30)27-28-24(31)15-29-21-9-5-3-7-18(21)25(32)19-8-4-6-10-22(19)29/h3-13,26H,14-15H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | MUHOHJUEHATHDR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|