C22H17FN2O2 — CID 15993730
N-(3-fluorophenyl)-2-(2-methyl-9-oxoacridin-10-yl)acetamide (PubChem CID 15993730) has the molecular formula C22H17FN2O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-(2-methyl-9-oxoacridin-10-yl)acetamide.
| Compound Name | N-(3-fluorophenyl)-2-(2-methyl-9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 15993730 |
| Molecular Formula | C22H17FN2O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-(3-fluorophenyl)-2-(2-methyl-9-oxoacridin-10-yl)acetamide |
| SMILES | Cc1ccc2c(c1)c(=O)c1ccccc1n2CC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C22H17FN2O2/c1-14-9-10-20-18(11-14)22(27)17-7-2-3-8-19(17)25(20)13-21(26)24-16-6-4-5-15(23)12-16/h2-12H,13H2,1H3,(H,24,26) |
| InChIKey | PIRJTUYWQRRZLW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|