C22H16ClFN2O2 — CID 6615384
2-(2-chloro-9-oxoacridin-10-yl)-N-(5-fluoro-2-methylphenyl)acetamide (PubChem CID 6615384) has the molecular formula C22H16ClFN2O2 and a molecular weight of 394.83 g/mol. Its IUPAC name is 2-(2-chloro-9-oxoacridin-10-yl)-N-(5-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-(2-chloro-9-oxoacridin-10-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 6615384 |
| Molecular Formula | C22H16ClFN2O2 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-(2-chloro-9-oxoacridin-10-yl)-N-(5-fluoro-2-methylphenyl)acetamide |
| SMILES | Cc1ccc(F)cc1NC(=O)Cn1c2ccccc2c(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H16ClFN2O2/c1-13-6-8-15(24)11-18(13)25-21(27)12-26-19-5-3-2-4-16(19)22(28)17-10-14(23)7-9-20(17)26/h2-11H,12H2,1H3,(H,25,27) |
| InChIKey | BGSKBNNUAUOYFV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|