C18H15ClN2O3 — CID 39767959
N-(5-chloro-2-hydroxyphenyl)-2-(4-methyl-2-oxoquinolin-1-yl)acetamide (PubChem CID 39767959) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2-(4-methyl-2-oxoquinolin-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2-(4-methyl-2-oxoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 39767959 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2-(4-methyl-2-oxoquinolin-1-yl)acetamide |
| SMILES | Cc1cc(=O)n(CC(=O)Nc2cc(Cl)ccc2O)c2ccccc12 |
| InChI | InChI=1S/C18H15ClN2O3/c1-11-8-18(24)21(15-5-3-2-4-13(11)15)10-17(23)20-14-9-12(19)6-7-16(14)22/h2-9,22H,10H2,1H3,(H,20,23) |
| InChIKey | ICJGISYXQIPYKM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|