C18H15ClN4O5 — CID 145469544
2-[1-[2-(5-chloro-2-hydroxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]acetamide (PubChem CID 145469544) has the molecular formula C18H15ClN4O5 and a molecular weight of 402.79 g/mol. Its IUPAC name is 2-[1-[2-(5-chloro-2-hydroxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]acetamide.
| Compound Name | 2-[1-[2-(5-chloro-2-hydroxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]acetamide |
|---|---|
| PubChem CID | 145469544 |
| Molecular Formula | C18H15ClN4O5 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2-[1-[2-(5-chloro-2-hydroxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]acetamide |
| SMILES | NC(=O)Cn1c(=O)c2ccccc2n(CC(=O)Nc2cc(Cl)ccc2O)c1=O |
| InChI | InChI=1S/C18H15ClN4O5/c19-10-5-6-14(24)12(7-10)21-16(26)9-22-13-4-2-1-3-11(13)17(27)23(18(22)28)8-15(20)25/h1-7,24H,8-9H2,(H2,20,25)(H,21,26) |
| InChIKey | OOSNLXORPNWFKS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 136.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|