C22H16ClFN2O3 — CID 6616650
N-(2-chloro-4-fluorophenyl)-2-(2-methoxy-9-oxoacridin-10-yl)acetamide (PubChem CID 6616650) has the molecular formula C22H16ClFN2O3 and a molecular weight of 410.83 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-(2-methoxy-9-oxoacridin-10-yl)acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-(2-methoxy-9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 6616650 |
| Molecular Formula | C22H16ClFN2O3 |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-(2-methoxy-9-oxoacridin-10-yl)acetamide |
| SMILES | COc1ccc2c(c1)c(=O)c1ccccc1n2CC(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H16ClFN2O3/c1-29-14-7-9-20-16(11-14)22(28)15-4-2-3-5-19(15)26(20)12-21(27)25-18-8-6-13(24)10-17(18)23/h2-11H,12H2,1H3,(H,25,27) |
| InChIKey | ZXFOEXJJPRRFGI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|