C21H16BrN3O3 — CID 15997885
N-(5-bromo-2-pyridinyl)-2-(2-methoxy-9-oxoacridin-10-yl)acetamide (PubChem CID 15997885) has the molecular formula C21H16BrN3O3 and a molecular weight of 438.28 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-(2-methoxy-9-oxoacridin-10-yl)acetamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-(2-methoxy-9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 15997885 |
| Molecular Formula | C21H16BrN3O3 |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-(2-methoxy-9-oxoacridin-10-yl)acetamide |
| SMILES | COc1ccc2c(c1)c(=O)c1ccccc1n2CC(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C21H16BrN3O3/c1-28-14-7-8-18-16(10-14)21(27)15-4-2-3-5-17(15)25(18)12-20(26)24-19-9-6-13(22)11-23-19/h2-11H,12H2,1H3,(H,23,24,26) |
| InChIKey | KGPLLZZHPVSBJY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|