C24H21N3O3 — CID 51339146
N,N-dimethyl-3-[[2-(9-oxoacridin-10-yl)acetyl]amino]benzamide (PubChem CID 51339146) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is N,N-dimethyl-3-[[2-(9-oxoacridin-10-yl)acetyl]amino]benzamide.
| Compound Name | N,N-dimethyl-3-[[2-(9-oxoacridin-10-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 51339146 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N,N-dimethyl-3-[[2-(9-oxoacridin-10-yl)acetyl]amino]benzamide |
| SMILES | CN(C)C(=O)c1cccc(NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C24H21N3O3/c1-26(2)24(30)16-8-7-9-17(14-16)25-22(28)15-27-20-12-5-3-10-18(20)23(29)19-11-4-6-13-21(19)27/h3-14H,15H2,1-2H3,(H,25,28) |
| InChIKey | XKYZBVXKRFOWDD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|