C32H29N3O2 — CID 22330387
N-(9-ethylcarbazol-3-yl)-4-(2-methyl-9-oxoacridin-10-yl)butanamide (PubChem CID 22330387) has the molecular formula C32H29N3O2 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-(9-ethylcarbazol-3-yl)-4-(2-methyl-9-oxoacridin-10-yl)butanamide.
| Compound Name | N-(9-ethylcarbazol-3-yl)-4-(2-methyl-9-oxoacridin-10-yl)butanamide |
|---|---|
| PubChem CID | 22330387 |
| Molecular Formula | C32H29N3O2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-(9-ethylcarbazol-3-yl)-4-(2-methyl-9-oxoacridin-10-yl)butanamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CCCn3c4ccccc4c(=O)c4cc(C)ccc43)ccc21 |
| InChI | InChI=1S/C32H29N3O2/c1-3-34-27-11-6-4-9-23(27)25-20-22(15-17-29(25)34)33-31(36)13-8-18-35-28-12-7-5-10-24(28)32(37)26-19-21(2)14-16-30(26)35/h4-7,9-12,14-17,19-20H,3,8,13,18H2,1-2H3,(H,33,36) |
| InChIKey | CDKUDXOLPBFSGN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|