C26H26N2O4 — CID 22330317
N-(2,4-dimethoxyphenyl)-4-(2-methyl-9-oxoacridin-10-yl)butanamide (PubChem CID 22330317) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(2-methyl-9-oxoacridin-10-yl)butanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(2-methyl-9-oxoacridin-10-yl)butanamide |
|---|---|
| PubChem CID | 22330317 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(2-methyl-9-oxoacridin-10-yl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCn2c3ccccc3c(=O)c3cc(C)ccc32)c(OC)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-17-10-13-23-20(15-17)26(30)19-7-4-5-8-22(19)28(23)14-6-9-25(29)27-21-12-11-18(31-2)16-24(21)32-3/h4-5,7-8,10-13,15-16H,6,9,14H2,1-3H3,(H,27,29) |
| InChIKey | FHUCOZHICLNGJH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|