C28H26N2O4 — CID 67024047
6-(12-ethyl-7,14-dioxoquinolino[2,3-b]acridin-5-yl)hexanoic acid (PubChem CID 67024047) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 6-(12-ethyl-7,14-dioxoquinolino[2,3-b]acridin-5-yl)hexanoic acid.
| Compound Name | 6-(12-ethyl-7,14-dioxoquinolino[2,3-b]acridin-5-yl)hexanoic acid |
|---|---|
| PubChem CID | 67024047 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 6-(12-ethyl-7,14-dioxoquinolino[2,3-b]acridin-5-yl)hexanoic acid |
| SMILES | CCn1c2ccccc2c(=O)c2cc3c(cc21)c(=O)c1ccccc1n3CCCCCC(=O)O |
| InChI | InChI=1S/C28H26N2O4/c1-2-29-22-12-7-5-10-18(22)27(33)20-17-25-21(16-24(20)29)28(34)19-11-6-8-13-23(19)30(25)15-9-3-4-14-26(31)32/h5-8,10-13,16-17H,2-4,9,14-15H2,1H3,(H,31,32) |
| InChIKey | QRNBUGIAMQWLJF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|