C22H25N3O4 — CID 66853989
2-[6-(9-oxoacridin-10-yl)hexanoylamino]ethylcarbamic acid (PubChem CID 66853989) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[6-(9-oxoacridin-10-yl)hexanoylamino]ethylcarbamic acid.
| Compound Name | 2-[6-(9-oxoacridin-10-yl)hexanoylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 66853989 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[6-(9-oxoacridin-10-yl)hexanoylamino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNC(=O)CCCCCn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C22H25N3O4/c26-20(23-13-14-24-22(28)29)12-2-1-7-15-25-18-10-5-3-8-16(18)21(27)17-9-4-6-11-19(17)25/h3-6,8-11,24H,1-2,7,12-15H2,(H,23,26)(H,28,29) |
| InChIKey | ZAKSSNFBYFMSTA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|