C20H20N2O4 — CID 70696942
6-(6,11-dioxobenzo[c][1]benzazepin-5-yl)-N-hydroxyhexanamide (PubChem CID 70696942) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 6-(6,11-dioxobenzo[c][1]benzazepin-5-yl)-N-hydroxyhexanamide.
| Compound Name | 6-(6,11-dioxobenzo[c][1]benzazepin-5-yl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 70696942 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 6-(6,11-dioxobenzo[c][1]benzazepin-5-yl)-N-hydroxyhexanamide |
| SMILES | O=C(CCCCCn1c(=O)c2ccccc2c(=O)c2ccccc21)NO |
| InChI | InChI=1S/C20H20N2O4/c23-18(21-26)12-2-1-7-13-22-17-11-6-5-10-16(17)19(24)14-8-3-4-9-15(14)20(22)25/h3-6,8-11,26H,1-2,7,12-13H2,(H,21,23) |
| InChIKey | DWGQSWDHTDLHAS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|