C19H18BrNO3 — CID 10194105
6-(2-bromo-9-oxoacridin-10-yl)hexanoic acid (PubChem CID 10194105) has the molecular formula C19H18BrNO3 and a molecular weight of 388.26 g/mol. Its IUPAC name is 6-(2-bromo-9-oxoacridin-10-yl)hexanoic acid.
| Compound Name | 6-(2-bromo-9-oxoacridin-10-yl)hexanoic acid |
|---|---|
| PubChem CID | 10194105 |
| Molecular Formula | C19H18BrNO3 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 6-(2-bromo-9-oxoacridin-10-yl)hexanoic acid |
| SMILES | O=C(O)CCCCCn1c2ccccc2c(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C19H18BrNO3/c20-13-9-10-17-15(12-13)19(24)14-6-3-4-7-16(14)21(17)11-5-1-2-8-18(22)23/h3-4,6-7,9-10,12H,1-2,5,8,11H2,(H,22,23) |
| InChIKey | GXFFSMVXBZVDEI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|