C23H28N2O4 — CID 51056130
11-(3-nitrocarbazol-9-yl)undecanoic acid (PubChem CID 51056130) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 11-(3-nitrocarbazol-9-yl)undecanoic acid.
| Compound Name | 11-(3-nitrocarbazol-9-yl)undecanoic acid |
|---|---|
| PubChem CID | 51056130 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 11-(3-nitrocarbazol-9-yl)undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCn1c2ccccc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H28N2O4/c26-23(27)13-7-5-3-1-2-4-6-10-16-24-21-12-9-8-11-19(21)20-17-18(25(28)29)14-15-22(20)24/h8-9,11-12,14-15,17H,1-7,10,13,16H2,(H,26,27) |
| InChIKey | QDLNHHSWJBQIJA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|