C20H13N3O5 — CID 23932157
2-(3,6-dinitrocarbazol-9-yl)-1-phenylethanone (PubChem CID 23932157) has the molecular formula C20H13N3O5 and a molecular weight of 375.34 g/mol. Its IUPAC name is 2-(3,6-dinitrocarbazol-9-yl)-1-phenylethanone.
| Compound Name | 2-(3,6-dinitrocarbazol-9-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 23932157 |
| Molecular Formula | C20H13N3O5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-(3,6-dinitrocarbazol-9-yl)-1-phenylethanone |
| SMILES | O=C(Cn1c2ccc([N+](=O)[O-])cc2c2cc([N+](=O)[O-])ccc21)c1ccccc1 |
| InChI | InChI=1S/C20H13N3O5/c24-20(13-4-2-1-3-5-13)12-21-18-8-6-14(22(25)26)10-16(18)17-11-15(23(27)28)7-9-19(17)21/h1-11H,12H2 |
| InChIKey | KWIJGUZBKGUUPE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 108.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|