C19H18N2O6 — CID 70182591
acetic acid;2-[2-methyl-3-(3-nitrophenyl)indol-1-yl]acetic acid (PubChem CID 70182591) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is acetic acid;2-[2-methyl-3-(3-nitrophenyl)indol-1-yl]acetic acid.
| Compound Name | acetic acid;2-[2-methyl-3-(3-nitrophenyl)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 70182591 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | acetic acid;2-[2-methyl-3-(3-nitrophenyl)indol-1-yl]acetic acid |
| SMILES | CC(=O)O.Cc1c(-c2cccc([N+](=O)[O-])c2)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C17H14N2O4.C2H4O2/c1-11-17(12-5-4-6-13(9-12)19(22)23)14-7-2-3-8-15(14)18(11)10-16(20)21;1-2(3)4/h2-9H,10H2,1H3,(H,20,21);1H3,(H,3,4) |
| InChIKey | FIQWMZZRHHPCFE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|