C15H11N3O6 — CID 54237838
2-(3,6-dinitrocarbazol-9-yl)propanoic acid (PubChem CID 54237838) has the molecular formula C15H11N3O6 and a molecular weight of 329.27 g/mol. Its IUPAC name is 2-(3,6-dinitrocarbazol-9-yl)propanoic acid.
| Compound Name | 2-(3,6-dinitrocarbazol-9-yl)propanoic acid |
|---|---|
| PubChem CID | 54237838 |
| Molecular Formula | C15H11N3O6 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-(3,6-dinitrocarbazol-9-yl)propanoic acid |
| SMILES | CC(C(=O)O)n1c2ccc([N+](=O)[O-])cc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H11N3O6/c1-8(15(19)20)16-13-4-2-9(17(21)22)6-11(13)12-7-10(18(23)24)3-5-14(12)16/h2-8H,1H3,(H,19,20) |
| InChIKey | QNVKCBZXFSPNFB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|