C19H13N3O4 — CID 5059102
9-benzyl-3,6-dinitrocarbazole (PubChem CID 5059102) has the molecular formula C19H13N3O4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 9-benzyl-3,6-dinitrocarbazole.
| Compound Name | 9-benzyl-3,6-dinitrocarbazole |
|---|---|
| PubChem CID | 5059102 |
| Molecular Formula | C19H13N3O4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 9-benzyl-3,6-dinitrocarbazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)c1cc([N+](=O)[O-])ccc1n2Cc1ccccc1 |
| InChI | InChI=1S/C19H13N3O4/c23-21(24)14-6-8-18-16(10-14)17-11-15(22(25)26)7-9-19(17)20(18)12-13-4-2-1-3-5-13/h1-11H,12H2 |
| InChIKey | RLMAEHHDDARVSK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 91.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|