About 3-nitro-9-phenylcarbazole;9-phenylcarbazole
3-nitro-9-phenylcarbazole;9-phenylcarbazole (PubChem CID 159323942) has the molecular formula C36H25N3O2
and a molecular weight of 531.62 g/mol. Its IUPAC name is 3-nitro-9-phenylcarbazole;9-phenylcarbazole.
Molecular Properties
| Compound Name | 3-nitro-9-phenylcarbazole;9-phenylcarbazole |
| PubChem CID | 159323942 |
| Molecular Formula | C36H25N3O2 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 3-nitro-9-phenylcarbazole;9-phenylcarbazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)c1ccccc1n2-c1ccccc1.c1ccc(-n2c3ccccc3c3ccccc32)cc1 |
| InChI | InChI=1S/C18H12N2O2.C18H13N/c21-20(22)14-10-11-18-16(12-14)15-8-4-5-9-17(15)19(18)13-6-2-1-3-7-13;1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19/h1-12H;1-13H |
| InChIKey | LECSCGGRZOCXFO-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 53.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-9-phenylcarbazole;9-phenylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-9-phenylcarbazole;9-phenylcarbazole?
The IUPAC name of 3-nitro-9-phenylcarbazole;9-phenylcarbazole (CID 159323942) is 3-nitro-9-phenylcarbazole;9-phenylcarbazole.
What is the SMILES notation for 3-nitro-9-phenylcarbazole;9-phenylcarbazole?
The canonical SMILES for 3-nitro-9-phenylcarbazole;9-phenylcarbazole is O=[N+]([O-])c1ccc2c(c1)c1ccccc1n2-c1ccccc1.c1ccc(-n2c3ccccc3c3ccccc32)cc1.
What is the InChIKey of 3-nitro-9-phenylcarbazole;9-phenylcarbazole?
The InChIKey is LECSCGGRZOCXFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2.C18H13N/c21-20(22)14-10-11-18-16(12-14)15-8-4-5-9-17(15)19(18)13-6-2-1-3-7-13;1-2-8-14(9-3-1)19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)19/h1-12H;1-13H.
What are the key properties of 3-nitro-9-phenylcarbazole;9-phenylcarbazole?
3-nitro-9-phenylcarbazole;9-phenylcarbazole has a molecular weight of 531.62 g/mol, XLogP of 9.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-9-phenylcarbazole;9-phenylcarbazole is sourced from PubChem (CID 159323942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).