C37H25N3O2 — CID 22944348
3-methyl-9-[4-[4-(3-nitrocarbazol-9-yl)phenyl]phenyl]carbazole (PubChem CID 22944348) has the molecular formula C37H25N3O2 and a molecular weight of 543.63 g/mol. Its IUPAC name is 3-methyl-9-[4-[4-(3-nitrocarbazol-9-yl)phenyl]phenyl]carbazole.
| Compound Name | 3-methyl-9-[4-[4-(3-nitrocarbazol-9-yl)phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 22944348 |
| Molecular Formula | C37H25N3O2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 3-methyl-9-[4-[4-(3-nitrocarbazol-9-yl)phenyl]phenyl]carbazole |
| SMILES | Cc1ccc2c(c1)c1ccccc1n2-c1ccc(-c2ccc(-n3c4ccccc4c4cc([N+](=O)[O-])ccc43)cc2)cc1 |
| InChI | InChI=1S/C37H25N3O2/c1-24-10-20-36-32(22-24)30-6-2-4-8-34(30)38(36)27-15-11-25(12-16-27)26-13-17-28(18-14-26)39-35-9-5-3-7-31(35)33-23-29(40(41)42)19-21-37(33)39/h2-23H,1H3 |
| InChIKey | NJOUJRDEKKCBIK-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 53.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|