C13H9N3O5 — CID 155908521
9-methoxy-3,6-dinitrocarbazole (PubChem CID 155908521) has the molecular formula C13H9N3O5 and a molecular weight of 287.23 g/mol. Its IUPAC name is 9-methoxy-3,6-dinitrocarbazole.
| Compound Name | 9-methoxy-3,6-dinitrocarbazole |
|---|---|
| PubChem CID | 155908521 |
| Molecular Formula | C13H9N3O5 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 9-methoxy-3,6-dinitrocarbazole |
| SMILES | COn1c2ccc([N+](=O)[O-])cc2c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C13H9N3O5/c1-21-14-12-4-2-8(15(17)18)6-10(12)11-7-9(16(19)20)3-5-13(11)14/h2-7H,1H3 |
| InChIKey | VKEVHAWVNCNFCD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 100.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|