C15H11N3O5 — CID 7038016
3,6-dinitro-9-[[(2R)-oxiran-2-yl]methyl]carbazole (PubChem CID 7038016) has the molecular formula C15H11N3O5 and a molecular weight of 313.27 g/mol. Its IUPAC name is 3,6-dinitro-9-[[(2R)-oxiran-2-yl]methyl]carbazole.
| Compound Name | 3,6-dinitro-9-[[(2R)-oxiran-2-yl]methyl]carbazole |
|---|---|
| PubChem CID | 7038016 |
| Molecular Formula | C15H11N3O5 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3,6-dinitro-9-[[(2R)-oxiran-2-yl]methyl]carbazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)c1cc([N+](=O)[O-])ccc1n2C[C@@H]1CO1 |
| InChI | InChI=1S/C15H11N3O5/c19-17(20)9-1-3-14-12(5-9)13-6-10(18(21)22)2-4-15(13)16(14)7-11-8-23-11/h1-6,11H,7-8H2/t11-/m1/s1 |
| InChIKey | UQYBJOCNWSELRR-LLVKDONJSA-N |
| XLogP | 3.01 |
| TPSA | 103.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|