C11H8N2O5 — CID 43197084
5-nitro-1-(oxiran-2-ylmethyl)indole-2,3-dione (PubChem CID 43197084) has the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 5-nitro-1-(oxiran-2-ylmethyl)indole-2,3-dione.
| Compound Name | 5-nitro-1-(oxiran-2-ylmethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 43197084 |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-nitro-1-(oxiran-2-ylmethyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC2CO2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H8N2O5/c14-10-8-3-6(13(16)17)1-2-9(8)12(11(10)15)4-7-5-18-7/h1-3,7H,4-5H2 |
| InChIKey | ZIQUMKDVLLXPQC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 93.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|