C12H10N2O7 — CID 82771259
3-hydroxy-4-(5-nitro-2,3-dioxoindol-1-yl)butanoic acid (PubChem CID 82771259) has the molecular formula C12H10N2O7 and a molecular weight of 294.22 g/mol. Its IUPAC name is 3-hydroxy-4-(5-nitro-2,3-dioxoindol-1-yl)butanoic acid.
| Compound Name | 3-hydroxy-4-(5-nitro-2,3-dioxoindol-1-yl)butanoic acid |
|---|---|
| PubChem CID | 82771259 |
| Molecular Formula | C12H10N2O7 |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3-hydroxy-4-(5-nitro-2,3-dioxoindol-1-yl)butanoic acid |
| SMILES | O=C(O)CC(O)CN1C(=O)C(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H10N2O7/c15-7(4-10(16)17)5-13-9-2-1-6(14(20)21)3-8(9)11(18)12(13)19/h1-3,7,15H,4-5H2,(H,16,17) |
| InChIKey | FOBBVZYOXKBRTH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|