C13H12N2O6 — CID 43365477
ethyl 3-(5-nitro-2,3-dioxoindol-1-yl)propanoate (PubChem CID 43365477) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is ethyl 3-(5-nitro-2,3-dioxoindol-1-yl)propanoate.
| Compound Name | ethyl 3-(5-nitro-2,3-dioxoindol-1-yl)propanoate |
|---|---|
| PubChem CID | 43365477 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | ethyl 3-(5-nitro-2,3-dioxoindol-1-yl)propanoate |
| SMILES | CCOC(=O)CCN1C(=O)C(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C13H12N2O6/c1-2-21-11(16)5-6-14-10-4-3-8(15(19)20)7-9(10)12(17)13(14)18/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | WNHWEHXXLIHKOK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|