C12H9N3O8 — CID 19772334
ethyl 2-(5,7-dinitro-2,3-dioxoindol-1-yl)acetate (PubChem CID 19772334) has the molecular formula C12H9N3O8 and a molecular weight of 323.22 g/mol. Its IUPAC name is ethyl 2-(5,7-dinitro-2,3-dioxoindol-1-yl)acetate.
| Compound Name | ethyl 2-(5,7-dinitro-2,3-dioxoindol-1-yl)acetate |
|---|---|
| PubChem CID | 19772334 |
| Molecular Formula | C12H9N3O8 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | ethyl 2-(5,7-dinitro-2,3-dioxoindol-1-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C12H9N3O8/c1-2-23-9(16)5-13-10-7(11(17)12(13)18)3-6(14(19)20)4-8(10)15(21)22/h3-4H,2,5H2,1H3 |
| InChIKey | NBXYEFALAUNUBL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|