C12H10N4O8 — CID 135721065
ethyl 2-(2-hydroxy-5,7-dinitro-3-nitrosoindol-1-yl)acetate (PubChem CID 135721065) has the molecular formula C12H10N4O8 and a molecular weight of 338.23 g/mol. Its IUPAC name is ethyl 2-(2-hydroxy-5,7-dinitro-3-nitrosoindol-1-yl)acetate.
| Compound Name | ethyl 2-(2-hydroxy-5,7-dinitro-3-nitrosoindol-1-yl)acetate |
|---|---|
| PubChem CID | 135721065 |
| Molecular Formula | C12H10N4O8 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | ethyl 2-(2-hydroxy-5,7-dinitro-3-nitrosoindol-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(O)c(N=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C12H10N4O8/c1-2-24-9(17)5-14-11-7(10(13-19)12(14)18)3-6(15(20)21)4-8(11)16(22)23/h3-4,18H,2,5H2,1H3 |
| InChIKey | YTZYRWGWQLWASV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 167.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|