C12H12N4O6 — CID 3094155
ethyl 2-(2-methyl-5,6-dinitrobenzimidazol-1-yl)acetate (PubChem CID 3094155) has the molecular formula C12H12N4O6 and a molecular weight of 308.25 g/mol. Its IUPAC name is ethyl 2-(2-methyl-5,6-dinitrobenzimidazol-1-yl)acetate.
| Compound Name | ethyl 2-(2-methyl-5,6-dinitrobenzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 3094155 |
| Molecular Formula | C12H12N4O6 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | ethyl 2-(2-methyl-5,6-dinitrobenzimidazol-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(C)nc2cc([N+](=O)[O-])c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H12N4O6/c1-3-22-12(17)6-14-7(2)13-8-4-10(15(18)19)11(16(20)21)5-9(8)14/h4-5H,3,6H2,1-2H3 |
| InChIKey | NFQQWISGMNYRDJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|