C10H15N3O4 — CID 103544847
methyl 5-amino-1-(2-ethoxy-2-oxoethyl)-2-methylimidazole-4-carboxylate (PubChem CID 103544847) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 5-amino-1-(2-ethoxy-2-oxoethyl)-2-methylimidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-(2-ethoxy-2-oxoethyl)-2-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 103544847 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | methyl 5-amino-1-(2-ethoxy-2-oxoethyl)-2-methylimidazole-4-carboxylate |
| SMILES | CCOC(=O)Cn1c(C)nc(C(=O)OC)c1N |
| InChI | InChI=1S/C10H15N3O4/c1-4-17-7(14)5-13-6(2)12-8(9(13)11)10(15)16-3/h4-5,11H2,1-3H3 |
| InChIKey | CESFSOXIUZADSE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |