C12H14BrN3O2S — CID 106039173
methyl 5-amino-1-[2-(5-bromothiophen-2-yl)ethyl]-2-methylimidazole-4-carboxylate (PubChem CID 106039173) has the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. Its IUPAC name is methyl 5-amino-1-[2-(5-bromothiophen-2-yl)ethyl]-2-methylimidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-[2-(5-bromothiophen-2-yl)ethyl]-2-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 106039173 |
| Molecular Formula | C12H14BrN3O2S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | methyl 5-amino-1-[2-(5-bromothiophen-2-yl)ethyl]-2-methylimidazole-4-carboxylate |
| SMILES | COC(=O)c1nc(C)n(CCc2ccc(Br)s2)c1N |
| InChI | InChI=1S/C12H14BrN3O2S/c1-7-15-10(12(17)18-2)11(14)16(7)6-5-8-3-4-9(13)19-8/h3-4H,5-6,14H2,1-2H3 |
| InChIKey | HNUJQMSPZWQUKN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |