C10H16N4O4 — CID 114162703
methyl 5-amino-1-[2-(2-amino-2-oxoethoxy)ethyl]-2-methylimidazole-4-carboxylate (PubChem CID 114162703) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is methyl 5-amino-1-[2-(2-amino-2-oxoethoxy)ethyl]-2-methylimidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-[2-(2-amino-2-oxoethoxy)ethyl]-2-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 114162703 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | methyl 5-amino-1-[2-(2-amino-2-oxoethoxy)ethyl]-2-methylimidazole-4-carboxylate |
| SMILES | COC(=O)c1nc(C)n(CCOCC(N)=O)c1N |
| InChI | InChI=1S/C10H16N4O4/c1-6-13-8(10(16)17-2)9(12)14(6)3-4-18-5-7(11)15/h3-5,12H2,1-2H3,(H2,11,15) |
| InChIKey | MUAXQNGIECWQOW-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|