C8H12N4O3 — CID 103544391
methyl 5-amino-1-(2-amino-2-oxoethyl)-2-methylimidazole-4-carboxylate (PubChem CID 103544391) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is methyl 5-amino-1-(2-amino-2-oxoethyl)-2-methylimidazole-4-carboxylate.
| Compound Name | methyl 5-amino-1-(2-amino-2-oxoethyl)-2-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 103544391 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | methyl 5-amino-1-(2-amino-2-oxoethyl)-2-methylimidazole-4-carboxylate |
| SMILES | COC(=O)c1nc(C)n(CC(N)=O)c1N |
| InChI | InChI=1S/C8H12N4O3/c1-4-11-6(8(14)15-2)7(10)12(4)3-5(9)13/h3,10H2,1-2H3,(H2,9,13) |
| InChIKey | SKVZVGBYTMUZRM-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |